C23H29N5O4 — CID 146441127
tert-butyl 4-[2-[(4-methoxyphenyl)methyl]-3-oxo-1H-pyrazolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate (PubChem CID 146441127) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-methoxyphenyl)methyl]-3-oxo-1H-pyrazolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-methoxyphenyl)methyl]-3-oxo-1H-pyrazolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146441127 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | tert-butyl 4-[2-[(4-methoxyphenyl)methyl]-3-oxo-1H-pyrazolo[3,4-d]pyrimidin-6-yl]piperidine-1-carboxylate |
| SMILES | COc1ccc(Cn2[nH]c3nc(C4CCN(C(=O)OC(C)(C)C)CC4)ncc3c2=O)cc1 |
| InChI | InChI=1S/C23H29N5O4/c1-23(2,3)32-22(30)27-11-9-16(10-12-27)19-24-13-18-20(25-19)26-28(21(18)29)14-15-5-7-17(31-4)8-6-15/h5-8,13,16H,9-12,14H2,1-4H3,(H,24,25,26) |
| InChIKey | HCRHRNLGGPWDPP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|