C26H35N5O5 — CID 178100038
tert-butyl 3-[2-butoxy-9-[(4-methoxyphenyl)methyl]-8-oxopurin-7-yl]pyrrolidine-1-carboxylate (PubChem CID 178100038) has the molecular formula C26H35N5O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is tert-butyl 3-[2-butoxy-9-[(4-methoxyphenyl)methyl]-8-oxopurin-7-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-butoxy-9-[(4-methoxyphenyl)methyl]-8-oxopurin-7-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 178100038 |
| Molecular Formula | C26H35N5O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | tert-butyl 3-[2-butoxy-9-[(4-methoxyphenyl)methyl]-8-oxopurin-7-yl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOc1ncc2c(n1)n(Cc1ccc(OC)cc1)c(=O)n2C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C26H35N5O5/c1-6-7-14-35-23-27-15-21-22(28-23)30(16-18-8-10-20(34-5)11-9-18)24(32)31(21)19-12-13-29(17-19)25(33)36-26(2,3)4/h8-11,15,19H,6-7,12-14,16-17H2,1-5H3 |
| InChIKey | OQQTZQWURFAVEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 100.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|