C16H23FN4O3 — CID 171092418
tert-butyl 4-[5-fluoro-2-(hydrazinecarbonyl)-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 171092418) has the molecular formula C16H23FN4O3 and a molecular weight of 338.38 g/mol. Its IUPAC name is tert-butyl 4-[5-fluoro-2-(hydrazinecarbonyl)-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-fluoro-2-(hydrazinecarbonyl)-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171092418 |
| Molecular Formula | C16H23FN4O3 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | tert-butyl 4-[5-fluoro-2-(hydrazinecarbonyl)-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(F)cnc2C(=O)NN)CC1 |
| InChI | InChI=1S/C16H23FN4O3/c1-16(2,3)24-15(23)21-6-4-10(5-7-21)12-8-11(17)9-19-13(12)14(22)20-18/h8-10H,4-7,18H2,1-3H3,(H,20,22) |
| InChIKey | CPRGMOMUEUGOID-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|