C18H19ClFN5O3 — CID 134584108
2-(3-chloro-4-fluorophenyl)-2-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]morpholine-4-carboxamide (PubChem CID 134584108) has the molecular formula C18H19ClFN5O3 and a molecular weight of 407.83 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-2-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]morpholine-4-carboxamide.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-2-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584108 |
| Molecular Formula | C18H19ClFN5O3 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-2-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]morpholine-4-carboxamide |
| SMILES | NNC(=O)c1ccc(CC2(c3ccc(F)c(Cl)c3)CN(C(N)=O)CCO2)nc1 |
| InChI | InChI=1S/C18H19ClFN5O3/c19-14-7-12(2-4-15(14)20)18(10-25(17(21)27)5-6-28-18)8-13-3-1-11(9-23-13)16(26)24-22/h1-4,7,9H,5-6,8,10,22H2,(H2,21,27)(H,24,26) |
| InChIKey | KGDHPADSQATAPL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|