C16H19F2N5O — CID 145295643
2-[[1-(3,4-difluorophenyl)cyclopropyl]amino]pyrimidine-5-carbohydrazide;ethane (PubChem CID 145295643) has the molecular formula C16H19F2N5O and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[[1-(3,4-difluorophenyl)cyclopropyl]amino]pyrimidine-5-carbohydrazide;ethane.
| Compound Name | 2-[[1-(3,4-difluorophenyl)cyclopropyl]amino]pyrimidine-5-carbohydrazide;ethane |
|---|---|
| PubChem CID | 145295643 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[[1-(3,4-difluorophenyl)cyclopropyl]amino]pyrimidine-5-carbohydrazide;ethane |
| SMILES | CC.NNC(=O)c1cnc(NC2(c3ccc(F)c(F)c3)CC2)nc1 |
| InChI | InChI=1S/C14H13F2N5O.C2H6/c15-10-2-1-9(5-11(10)16)14(3-4-14)20-13-18-6-8(7-19-13)12(22)21-17;1-2/h1-2,5-7H,3-4,17H2,(H,21,22)(H,18,19,20);1-2H3 |
| InChIKey | SSGCDCBHQSDKTC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|