C27H44N6O — CID 145295674
ethane;2-[[1-[4-(1-propan-2-ylpiperidin-4-yl)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide (PubChem CID 145295674) has the molecular formula C27H44N6O and a molecular weight of 468.69 g/mol. Its IUPAC name is ethane;2-[[1-[4-(1-propan-2-ylpiperidin-4-yl)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide.
| Compound Name | ethane;2-[[1-[4-(1-propan-2-ylpiperidin-4-yl)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 145295674 |
| Molecular Formula | C27H44N6O |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | ethane;2-[[1-[4-(1-propan-2-ylpiperidin-4-yl)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide |
| SMILES | CC.CC.CC(C)N1CCC(c2ccc(C3(Nc4ncc(C(=O)NN)cn4)CCC3)cc2)CC1 |
| InChI | InChI=1S/C23H32N6O.2C2H6/c1-16(2)29-12-8-18(9-13-29)17-4-6-20(7-5-17)23(10-3-11-23)27-22-25-14-19(15-26-22)21(30)28-24;2*1-2/h4-7,14-16,18H,3,8-13,24H2,1-2H3,(H,28,30)(H,25,26,27);2*1-2H3 |
| InChIKey | XMROFFXZNJSWSL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|