C17H21F2N5O — CID 145295547
2-[[1-(3,5-difluorophenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane (PubChem CID 145295547) has the molecular formula C17H21F2N5O and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[[1-(3,5-difluorophenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane.
| Compound Name | 2-[[1-(3,5-difluorophenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane |
|---|---|
| PubChem CID | 145295547 |
| Molecular Formula | C17H21F2N5O |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-[[1-(3,5-difluorophenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane |
| SMILES | CC.NNC(=O)c1cnc(NC2(c3cc(F)cc(F)c3)CCC2)nc1 |
| InChI | InChI=1S/C15H15F2N5O.C2H6/c16-11-4-10(5-12(17)6-11)15(2-1-3-15)21-14-19-7-9(8-20-14)13(23)22-18;1-2/h4-8H,1-3,18H2,(H,22,23)(H,19,20,21);1-2H3 |
| InChIKey | LIIQBLQSNKRXJZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|