C17H15ClF3N5O2 — CID 129032833
2-[[1-(5-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide (PubChem CID 129032833) has the molecular formula C17H15ClF3N5O2 and a molecular weight of 413.79 g/mol. Its IUPAC name is 2-[[1-(5-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide.
| Compound Name | 2-[[1-(5-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 129032833 |
| Molecular Formula | C17H15ClF3N5O2 |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[[1-(5-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide |
| SMILES | O=C(NNC(=O)C(F)F)c1cnc(NC2(c3cc(Cl)ccc3F)CCC2)nc1 |
| InChI | InChI=1S/C17H15ClF3N5O2/c18-10-2-3-12(19)11(6-10)17(4-1-5-17)24-16-22-7-9(8-23-16)14(27)25-26-15(28)13(20)21/h2-3,6-8,13H,1,4-5H2,(H,25,27)(H,26,28)(H,22,23,24) |
| InChIKey | LEMPXMHGGZVATK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|