C17H14ClF4N5O2 — CID 129033067
2-[[1-(3-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide (PubChem CID 129033067) has the molecular formula C17H14ClF4N5O2 and a molecular weight of 431.78 g/mol. Its IUPAC name is 2-[[1-(3-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide.
| Compound Name | 2-[[1-(3-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 129033067 |
| Molecular Formula | C17H14ClF4N5O2 |
| Molecular Weight | 431.78 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-[[1-(3-chloro-2-fluorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide |
| SMILES | O=C(NNC(=O)C(F)(F)F)c1cnc(NC2(c3cccc(Cl)c3F)CCC2)nc1 |
| InChI | InChI=1S/C17H14ClF4N5O2/c18-11-4-1-3-10(12(11)19)16(5-2-6-16)25-15-23-7-9(8-24-15)13(28)26-27-14(29)17(20,21)22/h1,3-4,7-8H,2,5-6H2,(H,26,28)(H,27,29)(H,23,24,25) |
| InChIKey | XZMFJTRSSMYGPH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|