C18H19ClF3N5O2 — CID 145295882
2-[[1-(4-chloro-2-fluorophenyl)cyclopropyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide;ethane (PubChem CID 145295882) has the molecular formula C18H19ClF3N5O2 and a molecular weight of 429.83 g/mol. Its IUPAC name is 2-[[1-(4-chloro-2-fluorophenyl)cyclopropyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide;ethane.
| Compound Name | 2-[[1-(4-chloro-2-fluorophenyl)cyclopropyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide;ethane |
|---|---|
| PubChem CID | 145295882 |
| Molecular Formula | C18H19ClF3N5O2 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-[[1-(4-chloro-2-fluorophenyl)cyclopropyl]amino]-N'-(2,2-difluoroacetyl)pyrimidine-5-carbohydrazide;ethane |
| SMILES | CC.O=C(NNC(=O)C(F)F)c1cnc(NC2(c3ccc(Cl)cc3F)CC2)nc1 |
| InChI | InChI=1S/C16H13ClF3N5O2.C2H6/c17-9-1-2-10(11(18)5-9)16(3-4-16)23-15-21-6-8(7-22-15)13(26)24-25-14(27)12(19)20;1-2/h1-2,5-7,12H,3-4H2,(H,24,26)(H,25,27)(H,21,22,23);1-2H3 |
| InChIKey | HFSZUKMVUPVXOP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|