C20H22F5N5O3 — CID 145295819
N'-(2,2-difluoroacetyl)-2-[[1-[2-(trifluoromethoxy)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane (PubChem CID 145295819) has the molecular formula C20H22F5N5O3 and a molecular weight of 475.42 g/mol. Its IUPAC name is N'-(2,2-difluoroacetyl)-2-[[1-[2-(trifluoromethoxy)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane.
| Compound Name | N'-(2,2-difluoroacetyl)-2-[[1-[2-(trifluoromethoxy)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane |
|---|---|
| PubChem CID | 145295819 |
| Molecular Formula | C20H22F5N5O3 |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N'-(2,2-difluoroacetyl)-2-[[1-[2-(trifluoromethoxy)phenyl]cyclobutyl]amino]pyrimidine-5-carbohydrazide;ethane |
| SMILES | CC.O=C(NNC(=O)C(F)F)c1cnc(NC2(c3ccccc3OC(F)(F)F)CCC2)nc1 |
| InChI | InChI=1S/C18H16F5N5O3.C2H6/c19-13(20)15(30)28-27-14(29)10-8-24-16(25-9-10)26-17(6-3-7-17)11-4-1-2-5-12(11)31-18(21,22)23;1-2/h1-2,4-5,8-9,13H,3,6-7H2,(H,27,29)(H,28,30)(H,24,25,26);1-2H3 |
| InChIKey | MCVHCYYRIGZIMM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|