C19H21ClF3N5O2 — CID 145295624
2-[[1-(2-chlorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide;ethane (PubChem CID 145295624) has the molecular formula C19H21ClF3N5O2 and a molecular weight of 443.86 g/mol. Its IUPAC name is 2-[[1-(2-chlorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide;ethane.
| Compound Name | 2-[[1-(2-chlorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide;ethane |
|---|---|
| PubChem CID | 145295624 |
| Molecular Formula | C19H21ClF3N5O2 |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[[1-(2-chlorophenyl)cyclobutyl]amino]-N'-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide;ethane |
| SMILES | CC.O=C(NNC(=O)C(F)(F)F)c1cnc(NC2(c3ccccc3Cl)CCC2)nc1 |
| InChI | InChI=1S/C17H15ClF3N5O2.C2H6/c18-12-5-2-1-4-11(12)16(6-3-7-16)24-15-22-8-10(9-23-15)13(27)25-26-14(28)17(19,20)21;1-2/h1-2,4-5,8-9H,3,6-7H2,(H,25,27)(H,26,28)(H,22,23,24);1-2H3 |
| InChIKey | UPJDVLVHEMXDJT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|