C19H21F2N5O — CID 129056588
N'-(3,3-difluoroprop-1-en-2-yl)-2-[[1-(4-methylphenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide (PubChem CID 129056588) has the molecular formula C19H21F2N5O and a molecular weight of 373.41 g/mol. Its IUPAC name is N'-(3,3-difluoroprop-1-en-2-yl)-2-[[1-(4-methylphenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide.
| Compound Name | N'-(3,3-difluoroprop-1-en-2-yl)-2-[[1-(4-methylphenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 129056588 |
| Molecular Formula | C19H21F2N5O |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N'-(3,3-difluoroprop-1-en-2-yl)-2-[[1-(4-methylphenyl)cyclobutyl]amino]pyrimidine-5-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cnc(NC2(c3ccc(C)cc3)CCC2)nc1)C(F)F |
| InChI | InChI=1S/C19H21F2N5O/c1-12-4-6-15(7-5-12)19(8-3-9-19)24-18-22-10-14(11-23-18)17(27)26-25-13(2)16(20)21/h4-7,10-11,16,25H,2-3,8-9H2,1H3,(H,26,27)(H,22,23,24) |
| InChIKey | RRCXMDNSNLWFDX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|