C17H20F3N5O — CID 145295636
ethane;2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carbohydrazide (PubChem CID 145295636) has the molecular formula C17H20F3N5O and a molecular weight of 367.38 g/mol. Its IUPAC name is ethane;2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carbohydrazide.
| Compound Name | ethane;2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 145295636 |
| Molecular Formula | C17H20F3N5O |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | ethane;2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carbohydrazide |
| SMILES | CC.NNC(=O)c1cnc(NC2(c3ccc(C(F)(F)F)cc3)CC2)nc1 |
| InChI | InChI=1S/C15H14F3N5O.C2H6/c16-15(17,18)11-3-1-10(2-4-11)14(5-6-14)22-13-20-7-9(8-21-13)12(24)23-19;1-2/h1-4,7-8H,5-6,19H2,(H,23,24)(H,20,21,22);1-2H3 |
| InChIKey | BMMNTOGWQOESII-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|