C19H22F3N3O2 — CID 145295737
ethane;ethyl 2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carboxylate (PubChem CID 145295737) has the molecular formula C19H22F3N3O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is ethane;ethyl 2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carboxylate.
| Compound Name | ethane;ethyl 2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 145295737 |
| Molecular Formula | C19H22F3N3O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethane;ethyl 2-[[1-[4-(trifluoromethyl)phenyl]cyclopropyl]amino]pyrimidine-5-carboxylate |
| SMILES | CC.CCOC(=O)c1cnc(NC2(c3ccc(C(F)(F)F)cc3)CC2)nc1 |
| InChI | InChI=1S/C17H16F3N3O2.C2H6/c1-2-25-14(24)11-9-21-15(22-10-11)23-16(7-8-16)12-3-5-13(6-4-12)17(18,19)20;1-2/h3-6,9-10H,2,7-8H2,1H3,(H,21,22,23);1-2H3 |
| InChIKey | NSPQRCXHANCTJZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |