C17H18BrN3O2 — CID 129032933
ethyl 2-[[1-(4-bromophenyl)cyclobutyl]amino]pyrimidine-5-carboxylate (PubChem CID 129032933) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is ethyl 2-[[1-(4-bromophenyl)cyclobutyl]amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[1-(4-bromophenyl)cyclobutyl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 129032933 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | ethyl 2-[[1-(4-bromophenyl)cyclobutyl]amino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC2(c3ccc(Br)cc3)CCC2)nc1 |
| InChI | InChI=1S/C17H18BrN3O2/c1-2-23-15(22)12-10-19-16(20-11-12)21-17(8-3-9-17)13-4-6-14(18)7-5-13/h4-7,10-11H,2-3,8-9H2,1H3,(H,19,20,21) |
| InChIKey | AKFCNRSKSAODHY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |