C17H18F3N5 — CID 145295570
5-(1-hydrazinylethenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]pyrimidin-2-amine (PubChem CID 145295570) has the molecular formula C17H18F3N5 and a molecular weight of 349.36 g/mol. Its IUPAC name is 5-(1-hydrazinylethenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]pyrimidin-2-amine.
| Compound Name | 5-(1-hydrazinylethenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 145295570 |
| Molecular Formula | C17H18F3N5 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 5-(1-hydrazinylethenyl)-N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]pyrimidin-2-amine |
| SMILES | C=C(NN)c1cnc(NC2(c3cccc(C(F)(F)F)c3)CCC2)nc1 |
| InChI | InChI=1S/C17H18F3N5/c1-11(25-21)12-9-22-15(23-10-12)24-16(6-3-7-16)13-4-2-5-14(8-13)17(18,19)20/h2,4-5,8-10,25H,1,3,6-7,21H2,(H,22,23,24) |
| InChIKey | LHMNJJBZINGJLF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|