C16H13F4N5O2 — CID 167428361
2-[[1-(4-fluorophenyl)cyclopropyl]amino]-N-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide (PubChem CID 167428361) has the molecular formula C16H13F4N5O2 and a molecular weight of 383.31 g/mol. Its IUPAC name is 2-[[1-(4-fluorophenyl)cyclopropyl]amino]-N-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide.
| Compound Name | 2-[[1-(4-fluorophenyl)cyclopropyl]amino]-N-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide |
|---|---|
| PubChem CID | 167428361 |
| Molecular Formula | C16H13F4N5O2 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[[1-(4-fluorophenyl)cyclopropyl]amino]-N-(2,2,2-trifluoroacetyl)pyrimidine-5-carbohydrazide |
| SMILES | NN(C(=O)c1cnc(NC2(c3ccc(F)cc3)CC2)nc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H13F4N5O2/c17-11-3-1-10(2-4-11)15(5-6-15)24-14-22-7-9(8-23-14)12(26)25(21)13(27)16(18,19)20/h1-4,7-8H,5-6,21H2,(H,22,23,24) |
| InChIKey | FEPCHHGHRJXPOC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|