C16H15Cl2N3O2 — CID 109153503
[6-(3,5-dichloroanilino)-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 109153503) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is [6-(3,5-dichloroanilino)-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [6-(3,5-dichloroanilino)-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109153503 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | [6-(3,5-dichloroanilino)-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(Nc2cc(Cl)cc(Cl)c2)nc1)N1CCOCC1 |
| InChI | InChI=1S/C16H15Cl2N3O2/c17-12-7-13(18)9-14(8-12)20-15-2-1-11(10-19-15)16(22)21-3-5-23-6-4-21/h1-2,7-10H,3-6H2,(H,19,20) |
| InChIKey | IPAQCMVUOBQPOM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |