C17H15Cl2N3O3 — CID 109083095
N-(3,5-dichlorophenyl)-2-(morpholine-4-carbonyl)pyridine-4-carboxamide (PubChem CID 109083095) has the molecular formula C17H15Cl2N3O3 and a molecular weight of 380.23 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(morpholine-4-carbonyl)pyridine-4-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(morpholine-4-carbonyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109083095 |
| Molecular Formula | C17H15Cl2N3O3 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(morpholine-4-carbonyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)c1ccnc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H15Cl2N3O3/c18-12-8-13(19)10-14(9-12)21-16(23)11-1-2-20-15(7-11)17(24)22-3-5-25-6-4-22/h1-2,7-10H,3-6H2,(H,21,23) |
| InChIKey | CFDBDTYFDNXYAM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |