C17H14F3N3O3 — CID 109083105
2-(morpholine-4-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide (PubChem CID 109083105) has the molecular formula C17H14F3N3O3 and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-(morpholine-4-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(morpholine-4-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109083105 |
| Molecular Formula | C17H14F3N3O3 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-(morpholine-4-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccnc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H14F3N3O3/c18-11-1-2-12(15(20)14(11)19)22-16(24)10-3-4-21-13(9-10)17(25)23-5-7-26-8-6-23/h1-4,9H,5-8H2,(H,22,24) |
| InChIKey | KFHRRXIYEZMAMP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|