C19H18F3N3O2 — CID 109090445
2-(3-methylpiperidine-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide (PubChem CID 109090445) has the molecular formula C19H18F3N3O2 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-(3-methylpiperidine-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(3-methylpiperidine-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109090445 |
| Molecular Formula | C19H18F3N3O2 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-(3-methylpiperidine-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
| SMILES | CC1CCCN(C(=O)c2cc(C(=O)Nc3ccc(F)c(F)c3F)ccn2)C1 |
| InChI | InChI=1S/C19H18F3N3O2/c1-11-3-2-8-25(10-11)19(27)15-9-12(6-7-23-15)18(26)24-14-5-4-13(20)16(21)17(14)22/h4-7,9,11H,2-3,8,10H2,1H3,(H,24,26) |
| InChIKey | YGSPTCAKMCHSRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|