C20H22ClN3O3 — CID 109090402
N-(5-chloro-2-methoxyphenyl)-2-(3-methylpiperidine-1-carbonyl)pyridine-4-carboxamide (PubChem CID 109090402) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-(3-methylpiperidine-1-carbonyl)pyridine-4-carboxamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-(3-methylpiperidine-1-carbonyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109090402 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-(3-methylpiperidine-1-carbonyl)pyridine-4-carboxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)c1ccnc(C(=O)N2CCCC(C)C2)c1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-13-4-3-9-24(12-13)20(26)17-10-14(7-8-22-17)19(25)23-16-11-15(21)5-6-18(16)27-2/h5-8,10-11,13H,3-4,9,12H2,1-2H3,(H,23,25) |
| InChIKey | YDWHLXQUTXZHKR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |