C20H25N3O3 — CID 109175778
N-(2,5-dimethoxyphenyl)-2-(3-methylpiperidin-1-yl)pyridine-4-carboxamide (PubChem CID 109175778) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(3-methylpiperidin-1-yl)pyridine-4-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(3-methylpiperidin-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109175778 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(3-methylpiperidin-1-yl)pyridine-4-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccnc(N3CCCC(C)C3)c2)c1 |
| InChI | InChI=1S/C20H25N3O3/c1-14-5-4-10-23(13-14)19-11-15(8-9-21-19)20(24)22-17-12-16(25-2)6-7-18(17)26-3/h6-9,11-12,14H,4-5,10,13H2,1-3H3,(H,22,24) |
| InChIKey | GNCHFWKDLXDZIH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |