C21H27N3O3 — CID 109175691
N-(2,5-dimethoxyphenyl)-2-(2-ethylpiperidin-1-yl)pyridine-4-carboxamide (PubChem CID 109175691) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-(2-ethylpiperidin-1-yl)pyridine-4-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-(2-ethylpiperidin-1-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109175691 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-(2-ethylpiperidin-1-yl)pyridine-4-carboxamide |
| SMILES | CCC1CCCCN1c1cc(C(=O)Nc2cc(OC)ccc2OC)ccn1 |
| InChI | InChI=1S/C21H27N3O3/c1-4-16-7-5-6-12-24(16)20-13-15(10-11-22-20)21(25)23-18-14-17(26-2)8-9-19(18)27-3/h8-11,13-14,16H,4-7,12H2,1-3H3,(H,23,25) |
| InChIKey | OBNMOHRLQDDHTQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |