C23H30N4O2 — CID 109175707
2-(2-ethylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)pyridine-4-carboxamide (PubChem CID 109175707) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-(2-ethylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)pyridine-4-carboxamide.
| Compound Name | 2-(2-ethylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109175707 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 2-(2-ethylpiperidin-1-yl)-N-(2-morpholin-4-ylphenyl)pyridine-4-carboxamide |
| SMILES | CCC1CCCCN1c1cc(C(=O)Nc2ccccc2N2CCOCC2)ccn1 |
| InChI | InChI=1S/C23H30N4O2/c1-2-19-7-5-6-12-27(19)22-17-18(10-11-24-22)23(28)25-20-8-3-4-9-21(20)26-13-15-29-16-14-26/h3-4,8-11,17,19H,2,5-7,12-16H2,1H3,(H,25,28) |
| InChIKey | UZZFKQMXTBIVNO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |