C21H14F3N3O2 — CID 109091631
2-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide (PubChem CID 109091631) has the molecular formula C21H14F3N3O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109091631 |
| Molecular Formula | C21H14F3N3O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccnc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C21H14F3N3O2/c22-14-5-6-15(19(24)18(14)23)26-20(28)13-7-9-25-16(11-13)21(29)27-10-8-12-3-1-2-4-17(12)27/h1-7,9,11H,8,10H2,(H,26,28) |
| InChIKey | ILPADYXWCJCXSH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|