C16H16F3N5O2 — CID 141220618
[6-[[4-amino-5-(trifluoromethyl)-2-pyridinyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone (PubChem CID 141220618) has the molecular formula C16H16F3N5O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is [6-[[4-amino-5-(trifluoromethyl)-2-pyridinyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone.
| Compound Name | [6-[[4-amino-5-(trifluoromethyl)-2-pyridinyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 141220618 |
| Molecular Formula | C16H16F3N5O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [6-[[4-amino-5-(trifluoromethyl)-2-pyridinyl]amino]-3-pyridinyl]-morpholin-4-ylmethanone |
| SMILES | Nc1cc(Nc2ccc(C(=O)N3CCOCC3)cn2)ncc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3N5O2/c17-16(18,19)11-9-22-14(7-12(11)20)23-13-2-1-10(8-21-13)15(25)24-3-5-26-6-4-24/h1-2,7-9H,3-6H2,(H3,20,21,22,23) |
| InChIKey | LHMLLVVAUKQHHD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |