C20H23N3O4 — CID 125021701
(2R)-4-[6-[(2-methoxyphenyl)methyl]pyridine-3-carbonyl]-2-methylmorpholine-2-carboxamide (PubChem CID 125021701) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2R)-4-[6-[(2-methoxyphenyl)methyl]pyridine-3-carbonyl]-2-methylmorpholine-2-carboxamide.
| Compound Name | (2R)-4-[6-[(2-methoxyphenyl)methyl]pyridine-3-carbonyl]-2-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 125021701 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2R)-4-[6-[(2-methoxyphenyl)methyl]pyridine-3-carbonyl]-2-methylmorpholine-2-carboxamide |
| SMILES | COc1ccccc1Cc1ccc(C(=O)N2CCO[C@@](C)(C(N)=O)C2)cn1 |
| InChI | InChI=1S/C20H23N3O4/c1-20(19(21)25)13-23(9-10-27-20)18(24)15-7-8-16(22-12-15)11-14-5-3-4-6-17(14)26-2/h3-8,12H,9-11,13H2,1-2H3,(H2,21,25)/t20-/m1/s1 |
| InChIKey | YLSMGZCJSJCWJB-HXUWFJFHSA-N |
| XLogP | 1.40 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |