C13H17N3O4 — CID 125015588
(2R)-4-(2-methoxypyridine-3-carbonyl)-2-methylmorpholine-2-carboxamide (PubChem CID 125015588) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is (2R)-4-(2-methoxypyridine-3-carbonyl)-2-methylmorpholine-2-carboxamide.
| Compound Name | (2R)-4-(2-methoxypyridine-3-carbonyl)-2-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 125015588 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | (2R)-4-(2-methoxypyridine-3-carbonyl)-2-methylmorpholine-2-carboxamide |
| SMILES | COc1ncccc1C(=O)N1CCO[C@@](C)(C(N)=O)C1 |
| InChI | InChI=1S/C13H17N3O4/c1-13(12(14)18)8-16(6-7-20-13)11(17)9-4-3-5-15-10(9)19-2/h3-5H,6-8H2,1-2H3,(H2,14,18)/t13-/m1/s1 |
| InChIKey | WUSZVIKFIXOHKX-CYBMUJFWSA-N |
| XLogP | -0.19 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |