C16H23N3O5 — CID 132777070
2-[2-(methoxymethyl)-4-(2-methoxypyridine-3-carbonyl)morpholin-2-yl]-N-methylacetamide (PubChem CID 132777070) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-[2-(methoxymethyl)-4-(2-methoxypyridine-3-carbonyl)morpholin-2-yl]-N-methylacetamide.
| Compound Name | 2-[2-(methoxymethyl)-4-(2-methoxypyridine-3-carbonyl)morpholin-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 132777070 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-[2-(methoxymethyl)-4-(2-methoxypyridine-3-carbonyl)morpholin-2-yl]-N-methylacetamide |
| SMILES | CNC(=O)CC1(COC)CN(C(=O)c2cccnc2OC)CCO1 |
| InChI | InChI=1S/C16H23N3O5/c1-17-13(20)9-16(11-22-2)10-19(7-8-24-16)15(21)12-5-4-6-18-14(12)23-3/h4-6H,7-11H2,1-3H3,(H,17,20) |
| InChIKey | QXGIJZRZLHNRDK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |