C12H18N4O3 — CID 95839579
(2R)-4-(1-ethylpyrazole-4-carbonyl)-2-methylmorpholine-2-carboxamide (PubChem CID 95839579) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2R)-4-(1-ethylpyrazole-4-carbonyl)-2-methylmorpholine-2-carboxamide.
| Compound Name | (2R)-4-(1-ethylpyrazole-4-carbonyl)-2-methylmorpholine-2-carboxamide |
|---|---|
| PubChem CID | 95839579 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2R)-4-(1-ethylpyrazole-4-carbonyl)-2-methylmorpholine-2-carboxamide |
| SMILES | CCn1cc(C(=O)N2CCO[C@@](C)(C(N)=O)C2)cn1 |
| InChI | InChI=1S/C12H18N4O3/c1-3-16-7-9(6-14-16)10(17)15-4-5-19-12(2,8-15)11(13)18/h6-7H,3-5,8H2,1-2H3,(H2,13,18)/t12-/m1/s1 |
| InChIKey | NJJOVKVLDQFCHU-GFCCVEGCSA-N |
| XLogP | -0.38 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |