C15H17N5O3 — CID 95839705
(2R)-2-methyl-4-[3-(1,2,4-triazol-4-yl)benzoyl]morpholine-2-carboxamide (PubChem CID 95839705) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is (2R)-2-methyl-4-[3-(1,2,4-triazol-4-yl)benzoyl]morpholine-2-carboxamide.
| Compound Name | (2R)-2-methyl-4-[3-(1,2,4-triazol-4-yl)benzoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 95839705 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (2R)-2-methyl-4-[3-(1,2,4-triazol-4-yl)benzoyl]morpholine-2-carboxamide |
| SMILES | C[C@]1(C(N)=O)CN(C(=O)c2cccc(-n3cnnc3)c2)CCO1 |
| InChI | InChI=1S/C15H17N5O3/c1-15(14(16)22)8-19(5-6-23-15)13(21)11-3-2-4-12(7-11)20-9-17-18-10-20/h2-4,7,9-10H,5-6,8H2,1H3,(H2,16,22)/t15-/m1/s1 |
| InChIKey | FRIDYMCPGQXPOD-OAHLLOKOSA-N |
| XLogP | -0.02 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |