C12H17N3O4 — CID 119248465
2-[4-(1-ethylpyrazole-4-carbonyl)morpholin-2-yl]acetic acid (PubChem CID 119248465) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[4-(1-ethylpyrazole-4-carbonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(1-ethylpyrazole-4-carbonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119248465 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[4-(1-ethylpyrazole-4-carbonyl)morpholin-2-yl]acetic acid |
| SMILES | CCn1cc(C(=O)N2CCOC(CC(=O)O)C2)cn1 |
| InChI | InChI=1S/C12H17N3O4/c1-2-15-7-9(6-13-15)12(18)14-3-4-19-10(8-14)5-11(16)17/h6-7,10H,2-5,8H2,1H3,(H,16,17) |
| InChIKey | ZYSLPAMGHUNNDM-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |