C11H16N4O3 — CID 73439576
2-methyl-4-(2-pyrazol-1-ylacetyl)morpholine-2-carboxamide (PubChem CID 73439576) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-methyl-4-(2-pyrazol-1-ylacetyl)morpholine-2-carboxamide.
| Compound Name | 2-methyl-4-(2-pyrazol-1-ylacetyl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 73439576 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-methyl-4-(2-pyrazol-1-ylacetyl)morpholine-2-carboxamide |
| SMILES | CC1(C(N)=O)CN(C(=O)Cn2cccn2)CCO1 |
| InChI | InChI=1S/C11H16N4O3/c1-11(10(12)17)8-14(5-6-18-11)9(16)7-15-4-2-3-13-15/h2-4H,5-8H2,1H3,(H2,12,17) |
| InChIKey | VVSVDIVIPDZVBP-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |