C20H24ClFN6O2 — CID 134584865
N-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 134584865) has the molecular formula C20H24ClFN6O2 and a molecular weight of 434.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 134584865 |
| Molecular Formula | C20H24ClFN6O2 |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(dimethylamino)-N-[[5-(hydrazinecarbonyl)-2-pyridinyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | CN(C)C1CCN(C(=O)N(Cc2ccc(C(=O)NN)cn2)c2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H24ClFN6O2/c1-26(2)16-7-8-27(12-16)20(30)28(15-5-6-18(22)17(21)9-15)11-14-4-3-13(10-24-14)19(29)25-23/h3-6,9-10,16H,7-8,11-12,23H2,1-2H3,(H,25,29) |
| InChIKey | FUURSSDXAFGAKB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|