C22H30N4O4S — CID 126507925
methyl 4-[(N-[methyl(2-piperazin-1-ylethyl)sulfamoyl]anilino)methyl]benzoate (PubChem CID 126507925) has the molecular formula C22H30N4O4S and a molecular weight of 446.57 g/mol. Its IUPAC name is methyl 4-[(N-[methyl(2-piperazin-1-ylethyl)sulfamoyl]anilino)methyl]benzoate.
| Compound Name | methyl 4-[(N-[methyl(2-piperazin-1-ylethyl)sulfamoyl]anilino)methyl]benzoate |
|---|---|
| PubChem CID | 126507925 |
| Molecular Formula | C22H30N4O4S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | methyl 4-[(N-[methyl(2-piperazin-1-ylethyl)sulfamoyl]anilino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(c2ccccc2)S(=O)(=O)N(C)CCN2CCNCC2)cc1 |
| InChI | InChI=1S/C22H30N4O4S/c1-24(16-17-25-14-12-23-13-15-25)31(28,29)26(21-6-4-3-5-7-21)18-19-8-10-20(11-9-19)22(27)30-2/h3-11,23H,12-18H2,1-2H3 |
| InChIKey | YRQCLNOYFTTWJY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |