C24H34N4O5S — CID 126545807
1-[4-[2-[[[4-[hydroxy(methoxy)methyl]phenyl]methyl-phenylsulfamoyl]-methylamino]ethyl]piperazin-1-yl]ethanone (PubChem CID 126545807) has the molecular formula C24H34N4O5S and a molecular weight of 490.63 g/mol. Its IUPAC name is 1-[4-[2-[[[4-[hydroxy(methoxy)methyl]phenyl]methyl-phenylsulfamoyl]-methylamino]ethyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[[[4-[hydroxy(methoxy)methyl]phenyl]methyl-phenylsulfamoyl]-methylamino]ethyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 126545807 |
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | 1-[4-[2-[[[4-[hydroxy(methoxy)methyl]phenyl]methyl-phenylsulfamoyl]-methylamino]ethyl]piperazin-1-yl]ethanone |
| SMILES | COC(O)c1ccc(CN(c2ccccc2)S(=O)(=O)N(C)CCN2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C24H34N4O5S/c1-20(29)27-17-15-26(16-18-27)14-13-25(2)34(31,32)28(23-7-5-4-6-8-23)19-21-9-11-22(12-10-21)24(30)33-3/h4-12,24,30H,13-19H2,1-3H3 |
| InChIKey | ZJEDZPSHUPPMDK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|