C27H28N2O3 — CID 46100480
methyl 4-[4-[(4-methylphenyl)-phenylmethyl]piperazine-1-carbonyl]benzoate (PubChem CID 46100480) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 4-[4-[(4-methylphenyl)-phenylmethyl]piperazine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[4-[(4-methylphenyl)-phenylmethyl]piperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 46100480 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | methyl 4-[4-[(4-methylphenyl)-phenylmethyl]piperazine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN(C(c3ccccc3)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-20-8-10-22(11-9-20)25(21-6-4-3-5-7-21)28-16-18-29(19-17-28)26(30)23-12-14-24(15-13-23)27(31)32-2/h3-15,25H,16-19H2,1-2H3 |
| InChIKey | UBGOFCDSJDUWOV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |