C32H32N2OS — CID 4666883
(4-benzhydrylpiperazin-1-yl)-[4-[(4-methylphenyl)sulfanylmethyl]phenyl]methanone (PubChem CID 4666883) has the molecular formula C32H32N2OS and a molecular weight of 492.69 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[4-[(4-methylphenyl)sulfanylmethyl]phenyl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[4-[(4-methylphenyl)sulfanylmethyl]phenyl]methanone |
|---|---|
| PubChem CID | 4666883 |
| Molecular Formula | C32H32N2OS |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[4-[(4-methylphenyl)sulfanylmethyl]phenyl]methanone |
| SMILES | Cc1ccc(SCc2ccc(C(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H32N2OS/c1-25-12-18-30(19-13-25)36-24-26-14-16-29(17-15-26)32(35)34-22-20-33(21-23-34)31(27-8-4-2-5-9-27)28-10-6-3-7-11-28/h2-19,31H,20-24H2,1H3 |
| InChIKey | ODDFKSSJTMPNBW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |