C25H33IN4O5S — CID 25055032
tert-butyl 3-[[4-(dimethylamino)phenyl]methylcarbamoyl]-4-(4-iodophenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 25055032) has the molecular formula C25H33IN4O5S and a molecular weight of 628.53 g/mol. Its IUPAC name is tert-butyl 3-[[4-(dimethylamino)phenyl]methylcarbamoyl]-4-(4-iodophenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 3-[[4-(dimethylamino)phenyl]methylcarbamoyl]-4-(4-iodophenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 25055032 |
| Molecular Formula | C25H33IN4O5S |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.12 |
| IUPAC Name | tert-butyl 3-[[4-(dimethylamino)phenyl]methylcarbamoyl]-4-(4-iodophenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | CN(C)c1ccc(CNC(=O)C2CN(C(=O)OC(C)(C)C)CCN2S(=O)(=O)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C25H33IN4O5S/c1-25(2,3)35-24(32)29-14-15-30(36(33,34)21-12-8-19(26)9-13-21)22(17-29)23(31)27-16-18-6-10-20(11-7-18)28(4)5/h6-13,22H,14-17H2,1-5H3,(H,27,31) |
| InChIKey | SHKKNUASAYYLDM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|