C24H32IN5O4S — CID 25055278
4-[2-(dimethylamino)acetyl]-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 25055278) has the molecular formula C24H32IN5O4S and a molecular weight of 613.52 g/mol. Its IUPAC name is 4-[2-(dimethylamino)acetyl]-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | 4-[2-(dimethylamino)acetyl]-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 25055278 |
| Molecular Formula | C24H32IN5O4S |
| Molecular Weight | 613.52 g/mol |
| Exact Mass | 613.12 |
| IUPAC Name | 4-[2-(dimethylamino)acetyl]-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | CN(C)CC(=O)N1CCN(S(=O)(=O)c2ccc(I)cc2)C(C(=O)NCc2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C24H32IN5O4S/c1-27(2)17-23(31)29-13-14-30(35(33,34)21-11-7-19(25)8-12-21)22(16-29)24(32)26-15-18-5-9-20(10-6-18)28(3)4/h5-12,22H,13-17H2,1-4H3,(H,26,32) |
| InChIKey | SVGCDNVANQENGT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|