C23H30IN5O4S — CID 67412541
4-(3-aminopropanoyl)-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide (PubChem CID 67412541) has the molecular formula C23H30IN5O4S and a molecular weight of 599.50 g/mol. Its IUPAC name is 4-(3-aminopropanoyl)-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide.
| Compound Name | 4-(3-aminopropanoyl)-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 67412541 |
| Molecular Formula | C23H30IN5O4S |
| Molecular Weight | 599.50 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | 4-(3-aminopropanoyl)-N-[[4-(dimethylamino)phenyl]methyl]-1-(4-iodophenyl)sulfonylpiperazine-2-carboxamide |
| SMILES | CN(C)c1ccc(CNC(=O)C2CN(C(=O)CCN)CCN2S(=O)(=O)c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C23H30IN5O4S/c1-27(2)19-7-3-17(4-8-19)15-26-23(31)21-16-28(22(30)11-12-25)13-14-29(21)34(32,33)20-9-5-18(24)6-10-20/h3-10,21H,11-16,25H2,1-2H3,(H,26,31) |
| InChIKey | SEEQYAPRDHVRLZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|