C31H40F3N3O6S — CID 67407464
ethyl 7-oxo-7-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]heptanoate (PubChem CID 67407464) has the molecular formula C31H40F3N3O6S and a molecular weight of 639.74 g/mol. Its IUPAC name is ethyl 7-oxo-7-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]heptanoate.
| Compound Name | ethyl 7-oxo-7-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]heptanoate |
|---|---|
| PubChem CID | 67407464 |
| Molecular Formula | C31H40F3N3O6S |
| Molecular Weight | 639.74 g/mol |
| Exact Mass | 639.26 |
| IUPAC Name | ethyl 7-oxo-7-[(3R)-3-[(4-propan-2-ylphenyl)methylcarbamoyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCC(=O)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)[C@@H](C(=O)NCc2ccc(C(C)C)cc2)C1 |
| InChI | InChI=1S/C31H40F3N3O6S/c1-4-43-29(39)9-7-5-6-8-28(38)36-18-19-37(44(41,42)26-16-14-25(15-17-26)31(32,33)34)27(21-36)30(40)35-20-23-10-12-24(13-11-23)22(2)3/h10-17,22,27H,4-9,18-21H2,1-3H3,(H,35,40)/t27-/m1/s1 |
| InChIKey | YXPHFKWQSBQJFE-HHHXNRCGSA-N |
| XLogP | 4.86 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|