C23H26F3N3O4S — CID 25053990
4-formyl-1-(4-propan-2-ylphenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2-carboxamide (PubChem CID 25053990) has the molecular formula C23H26F3N3O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is 4-formyl-1-(4-propan-2-ylphenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2-carboxamide.
| Compound Name | 4-formyl-1-(4-propan-2-ylphenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 25053990 |
| Molecular Formula | C23H26F3N3O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 4-formyl-1-(4-propan-2-ylphenyl)sulfonyl-N-[[4-(trifluoromethyl)phenyl]methyl]piperazine-2-carboxamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCN(C=O)CC2C(=O)NCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H26F3N3O4S/c1-16(2)18-5-9-20(10-6-18)34(32,33)29-12-11-28(15-30)14-21(29)22(31)27-13-17-3-7-19(8-4-17)23(24,25)26/h3-10,15-16,21H,11-14H2,1-2H3,(H,27,31) |
| InChIKey | INGZBRTXOQVEBH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|