C23H30N2O6S2 — CID 167908879
3-[benzyl(ethyl)sulfamoyl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-methoxybenzamide (PubChem CID 167908879) has the molecular formula C23H30N2O6S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[benzyl(ethyl)sulfamoyl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-methoxybenzamide.
| Compound Name | 3-[benzyl(ethyl)sulfamoyl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-methoxybenzamide |
|---|---|
| PubChem CID | 167908879 |
| Molecular Formula | C23H30N2O6S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-[benzyl(ethyl)sulfamoyl]-N-(1,1-dioxothiolan-3-yl)-N-ethyl-4-methoxybenzamide |
| SMILES | CCN(C(=O)c1ccc(OC)c(S(=O)(=O)N(CC)Cc2ccccc2)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H30N2O6S2/c1-4-24(16-18-9-7-6-8-10-18)33(29,30)22-15-19(11-12-21(22)31-3)23(26)25(5-2)20-13-14-32(27,28)17-20/h6-12,15,20H,4-5,13-14,16-17H2,1-3H3 |
| InChIKey | KDNLIYYSGUMKKL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |