C12H15ClFNO4S2 — CID 79177232
4-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 79177232) has the molecular formula C12H15ClFNO4S2 and a molecular weight of 355.84 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 4-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79177232 |
| Molecular Formula | C12H15ClFNO4S2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 4-(chloromethyl)-N-(1,1-dioxothiolan-3-yl)-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccc(CCl)cc1F |
| InChI | InChI=1S/C12H15ClFNO4S2/c1-15(10-4-5-20(16,17)8-10)21(18,19)12-3-2-9(7-13)6-11(12)14/h2-3,6,10H,4-5,7-8H2,1H3 |
| InChIKey | KMRJVSIVFJSKSQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|