C13H16N2O4S2 — CID 106832945
4-cyano-N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbenzenesulfonamide (PubChem CID 106832945) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-cyano-N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbenzenesulfonamide.
| Compound Name | 4-cyano-N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106832945 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 4-cyano-N-(1,1-dioxothiolan-3-yl)-N,3-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CCS(=O)(=O)C2)ccc1C#N |
| InChI | InChI=1S/C13H16N2O4S2/c1-10-7-13(4-3-11(10)8-14)21(18,19)15(2)12-5-6-20(16,17)9-12/h3-4,7,12H,5-6,9H2,1-2H3 |
| InChIKey | NJPWSTSLXJDMRH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |