C19H24N2O5S3 — CID 55984153
N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55984153) has the molecular formula C19H24N2O5S3 and a molecular weight of 456.61 g/mol. Its IUPAC name is N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55984153 |
| Molecular Formula | C19H24N2O5S3 |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-butyl-N-(1,1-dioxothiolan-3-yl)-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CCCCN(C(=O)c1ccc(NS(=O)(=O)c2cccs2)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H24N2O5S3/c1-2-3-11-21(17-10-13-28(23,24)14-17)19(22)15-6-8-16(9-7-15)20-29(25,26)18-5-4-12-27-18/h4-9,12,17,20H,2-3,10-11,13-14H2,1H3 |
| InChIKey | CGROVQDZRUNESI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |