C15H17BrFNO3 — CID 76950062
3-[3-(5-bromo-2-fluorophenyl)prop-2-enoyl-ethylamino]butanoic acid (PubChem CID 76950062) has the molecular formula C15H17BrFNO3 and a molecular weight of 358.21 g/mol. Its IUPAC name is 3-[3-(5-bromo-2-fluorophenyl)prop-2-enoyl-ethylamino]butanoic acid.
| Compound Name | 3-[3-(5-bromo-2-fluorophenyl)prop-2-enoyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 76950062 |
| Molecular Formula | C15H17BrFNO3 |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-[3-(5-bromo-2-fluorophenyl)prop-2-enoyl-ethylamino]butanoic acid |
| SMILES | CCN(C(=O)C=Cc1cc(Br)ccc1F)C(C)CC(=O)O |
| InChI | InChI=1S/C15H17BrFNO3/c1-3-18(10(2)8-15(20)21)14(19)7-4-11-9-12(16)5-6-13(11)17/h4-7,9-10H,3,8H2,1-2H3,(H,20,21) |
| InChIKey | FGJRXBSYRIOZAE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|